CAS 852934-06-6

Benzenemethanamine, α-(4-ethylphenyl)-3-fluoro-

Description:

Benzenemethanamine, α-(4-ethylphenyl)-3-fluoro-, also known by its CAS number 852934-06-6, is an organic compound characterized by its amine functional group attached to a benzene ring. This compound features a fluorine atom and an ethyl group on the aromatic system, which can influence its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents due to their hydrophobic aromatic structure, while the presence of the amine group can impart basicity and potential for hydrogen bonding. The fluorine substituent may enhance the compound's lipophilicity and alter its electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the specific arrangement of substituents can affect the compound's biological activity, making it relevant for research in pharmacology and drug design. Safety and handling considerations should be taken into account, as with many amines, due to potential toxicity and reactivity.

Formula: C₁₅H₁₆FN

InChI: InChI=1S/C15H16FN/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(16)10-13/h3-10,15H,2,17H2,1H3

InChI key: InChIKey=XSLJZWFJXPANEX-UHFFFAOYSA-N

SMILES: C(N)(C1=CC(F)=CC=C1)C2=CC=C(CC)C=C2

Synonyms:

• Benzenemethanamine, α-(4-ethylphenyl)-3-fluoro-

(4-Ethylphenyl)(3-fluorophenyl)methanamine

CAS: 852934-06-6

Versatile small molecule scaffold

Formula: C₁₅H₁₆FN

Purity: Min. 95%

Molecular weight: 229.3 g/mol

Ref: 3D-CJB93406