
CAS 852940-48-8
:2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-phenylethanone
Description:
2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-phenylethanone, with the CAS number 852940-48-8, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and a phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The difluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological targets. As a ketone, it possesses a carbonyl functional group, which can participate in various chemical reactions, including nucleophilic additions. The presence of multiple functional groups suggests that this compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Overall, this compound's unique structural features may lead to diverse applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C16H12F2N2O
InChI:InChI=1S/C16H12F2N2O/c17-16(18)20-13-9-5-4-8-12(13)19-15(20)10-14(21)11-6-2-1-3-7-11/h1-9,16H,10H2
InChI key:InChIKey=PKBSVDFYTLCLJU-UHFFFAOYSA-N
SMILES:C(F)(F)N1C=2C(N=C1CC(=O)C3=CC=CC=C3)=CC=CC2
Synonyms:- 2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-phenylethanone
- Ethanone, 2-[1-(difluoromethyl)-1H-benzimidazol-2-yl]-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.