CymitQuimica logo

CAS 852956-31-1

:

5-[(2-Thienylmethyl)thio]-1,3,4-thiadiazole-2(3H)-thione

Description:
5-[(2-Thienylmethyl)thio]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a thienylmethyl group, indicating the presence of a thiophene ring attached via a methylthio linkage. The thiadiazole moiety contributes to its potential biological activity, as compounds containing thiadiazole structures are often investigated for their pharmacological properties. The thione functional group (–C=S) suggests that the compound may exhibit reactivity typical of thiones, such as coordination with metal ions or participation in nucleophilic reactions. Additionally, the presence of sulfur in both the thiadiazole and thienyl groups may impart unique electronic properties, influencing its solubility and reactivity. Overall, this compound's structural features suggest potential applications in medicinal chemistry and materials science, although specific biological activities would require further investigation through experimental studies.
Formula:C7H6N2S4
InChI:InChI=1S/C7H6N2S4/c10-6-8-9-7(13-6)12-4-5-2-1-3-11-5/h1-3H,4H2,(H,8,10)
InChI key:InChIKey=HINQNJUGIPMQCH-UHFFFAOYSA-N
SMILES:S(CC1=CC=CS1)C2=NNC(=S)S2
Synonyms:
  • 1,3,4-Thiadiazole-2(3H)-thione, 5-[(2-thienylmethyl)thio]-
  • 5-[(2-Thienylmethyl)thio]-1,3,4-thiadiazole-2(3H)-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.