CAS 852956-39-9

N-[2-[[(5-Bromo-2-thienyl)methyl]thio]ethyl]-2-chloroacetamide

Description:

N-[2-[[(5-Bromo-2-thienyl)methyl]thio]ethyl]-2-chloroacetamide, identified by its CAS number 852956-39-9, is a synthetic organic compound characterized by its unique structural features. It contains a thienyl group, which is a five-membered aromatic ring containing sulfur, contributing to its potential biological activity. The presence of a bromine atom enhances its reactivity and may influence its pharmacological properties. The compound also features a chloroacetamide functional group, which is known for its role in various chemical reactions and biological interactions. Its thioether linkage suggests potential for nucleophilic substitution reactions. This compound may exhibit specific solubility characteristics, likely being soluble in organic solvents while having limited solubility in water due to its hydrophobic thienyl structure. The overall molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds can serve as intermediates or active pharmaceutical ingredients. Further studies would be necessary to fully elucidate its properties and potential uses in various chemical and biological contexts.

Formula: C₉H₁₁BrClNOS₂

InChI: InChI=1S/C9H11BrClNOS2/c10-8-2-1-7(15-8)6-14-4-3-12-9(13)5-11/h1-2H,3-6H2,(H,12,13)

InChI key: InChIKey=KODFJQLYAYTMRM-UHFFFAOYSA-N

SMILES: C(SCCNC(CCl)=O)C1=CC=C(Br)S1

Synonyms:

• Acetamide, N-[2-[[(5-bromo-2-thienyl)methyl]thio]ethyl]-2-chloro-
• N-[2-[[(5-Bromo-2-thienyl)methyl]thio]ethyl]-2-chloroacetamide