
CAS 85302-08-5
:2-[(Dimethylamino)methylene]-5-phenyl-1,3-cyclohexanedione
Description:
2-[(Dimethylamino)methylene]-5-phenyl-1,3-cyclohexanedione, with the CAS number 85302-08-5, is an organic compound characterized by its unique structure that includes a cyclohexanedione core substituted with a dimethylamino group and a phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in organic synthesis and medicinal chemistry due to its ability to participate in various chemical reactions. The presence of the dimethylamino group suggests that it may exhibit basic properties, while the cyclohexanedione framework can engage in tautomerization and other reactivity patterns common to diketones. Additionally, the phenyl substituent may influence the compound's electronic properties and solubility in organic solvents. Overall, this compound's structural features contribute to its potential utility in research and development within the fields of pharmaceuticals and materials science. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C15H17NO2
InChI:InChI=1S/C15H17NO2/c1-16(2)10-13-14(17)8-12(9-15(13)18)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
InChI key:InChIKey=CLDKBLQYVMASMX-UHFFFAOYSA-N
SMILES:O=C1CC(CC(=O)C1=CN(C)C)C2=CC=CC=C2
Synonyms:- 2-[(Dimethylamino)methylene]-5-phenylcyclohex-an-1,3-dione
- 2-[(Dimethylamino)methylene]-5-phenyl-1,3-cyclohexanedione
- 2-(Dimethylaminomethylidene)-5-phenylcyclohexane-1,3-dione
- 1,3-Cyclohexanedione, 2-[(dimethylamino)methylene]-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.