
CAS 85304-04-7
:2,5-Dimethylbenzoic acid hydrazide
Description:
2,5-Dimethylbenzoic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to a benzoic acid derivative. This compound features a benzene ring substituted with two methyl groups at the 2 and 5 positions, which influences its physical and chemical properties. It typically appears as a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazide group. The compound is likely to participate in various chemical reactions, including those typical of hydrazides, such as condensation reactions and potential formation of hydrazones. Its structure suggests that it may have applications in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of the methyl groups can affect its reactivity and stability, making it an interesting subject for further study in the fields of medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-6-3-4-7(2)8(5-6)9(12)11-10/h3-5H,10H2,1-2H3,(H,11,12)
InChI key:InChIKey=QYQCBFCXHDJPPK-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(C)C=CC(C)=C1
Synonyms:- 2,5-Dimethylbenzohydrazide
- 2,5-Dimethylbenzoic acid hydrazide
- Benzoic acid, 2,5-dimethyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.