CAS 85305-25-5
:Dipropanolamine
Description:
Dipropanolamine, with the CAS number 85305-25-5, is an organic compound that belongs to the class of alkanolamines. It is characterized by the presence of two hydroxyl (–OH) groups and an amine (–NH) group, which contribute to its properties as a surfactant and emulsifying agent. Dipropanolamine is typically a colorless to pale yellow liquid with a mild odor. It is hygroscopic, meaning it can absorb moisture from the air, and is soluble in water and various organic solvents. This compound exhibits both basic and amphoteric characteristics, allowing it to interact with acids and bases. Dipropanolamine is commonly used in personal care products, industrial formulations, and as a chemical intermediate in the production of other compounds. Its applications include serving as a pH adjuster, a corrosion inhibitor, and a stabilizer in various formulations. Safety considerations include potential skin and eye irritation, necessitating appropriate handling measures in industrial and laboratory settings.
Formula:C6H15NO2
InChI:InChI=1/C6H15NO2/c1-3-5(8)7-6(9)4-2/h5-9H,3-4H2,1-2H3
SMILES:CCC(NC(CC)O)O
Synonyms:- 1,1'-Iminodipropan-1-Ol
- Dipropanolamine
- Iminobispropanol
- Propanol, iminobis-
- Iminodipropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.