CAS 853058-40-9

1H-Pyrrole-2,4-dicarboxylicacid,3-amino-,dimethylester(9CI)

Description:

1H-Pyrrole-2,4-dicarboxylic acid, 3-amino-, dimethyl ester (CAS 853058-40-9) is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two carboxylic acid groups and an amino group, contributing to its potential as a versatile building block in organic synthesis. The dimethyl ester form indicates that the carboxylic acid groups are esterified with methyl groups, enhancing its solubility and reactivity. The presence of the amino group suggests potential for further functionalization, making it useful in medicinal chemistry and materials science. The compound may exhibit biological activity, and its derivatives could be explored for pharmaceutical applications. Additionally, its structural features may allow for interactions with various biological targets, making it of interest in drug development. As with many pyrrole derivatives, it may also possess unique electronic properties due to the conjugated system within the ring. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₈H₁₀N₂O₄

InChI: InChI=1/C8H10N2O4/c1-13-7(11)4-3-10-6(5(4)9)8(12)14-2/h3,10H,9H2,1-2H3

SMILES: COC(=O)c1c[nH]c(c1N)C(=O)OC

Synonyms:

• dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate

Diethyl 3-amino-1H-pyrrole-2,4-dicarboxylate

CAS: 853058-40-9

Formula: C₁₀H₁₄N₂O₄

Purity: 95%

Molecular weight: 226.2292

Ref: IN-DA004LP3

DIETHYL 3-AMINO-1H-PYRROLE-2,4-DICARBOXYLATE

CAS: 853058-40-9

Formula: C₁₀H₁₄N₂O₄

Purity: 95.0%

Molecular weight: 226.232

Ref: 10-F332562