CAS 853058-43-2
:5H-Pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-, lithium salt (1:1)
Description:
5H-Pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-, lithium salt (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a chlorine substituent at the 4-position of the pyrimidine ring, which can influence its reactivity and solubility. The lithium salt form indicates that lithium ions are associated with the carboxylate group, enhancing its stability and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its structural characteristics suggest potential interactions with biological targets, and its lithium salt form may also impart unique electrochemical properties. Overall, this compound represents a class of heterocyclic compounds that are valuable in medicinal chemistry and materials science.
Formula:C7H4ClN3O2·Li
InChI:InChI=1S/C7H4ClN3O2.Li/c8-6-5-4(10-2-11-6)3(1-9-5)7(12)13;/h1-2,9H,(H,12,13);
InChI key:InChIKey=MAPKEFXHIHRZKB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=C(Cl)N=CN2.[Li]
Synonyms:- 5H-Pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-, lithium salt
- 5H-Pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-, lithium salt (1:1)
- 5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lithium 4-chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylate
CAS:Formula:C7H4ClN3O2Molecular weight:197.5786
