CAS 853104-20-8

3-phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole

Description:

3-Phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole is a heterocyclic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features a phenyl group and a pyrrolidine moiety, contributing to its potential biological activity and chemical reactivity. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry. The presence of the pyrrolidine group may enhance its lipophilicity and influence its interaction with biological targets. This compound is of interest in pharmaceutical research, particularly for its potential applications in drug development, as it may exhibit unique pharmacological properties. Additionally, the specific arrangement of substituents on the oxadiazole ring can affect its electronic properties and reactivity, making it a subject of study in the field of organic synthesis and materials science.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1/C12H13N3O/c1-2-5-9(6-3-1)11-14-12(16-15-11)10-7-4-8-13-10/h1-3,5-6,10,13H,4,7-8H2

SMILES: c1ccc(cc1)c1nc(C2CCCN2)on1

3-phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole

CAS: 853104-20-8

Formula: C₁₂H₁₃N₃O

Purity: 95.0%

Molecular weight: 215.256

Ref: 10-F385635