CAS 853138-65-5
:2-(1H-indol-3-yl)-N-methyl-N-(2-{[4-(1-methylethyl)phenyl]amino}-2-oxo-1-phenylethyl)acetamide
Description:
The chemical substance known as 2-(1H-indol-3-yl)-N-methyl-N-(2-{[4-(1-methylethyl)phenyl]amino}-2-oxo-1-phenylethyl)acetamide, with the CAS number 853138-65-5, is a complex organic compound characterized by its multi-functional structure. It features an indole moiety, which is known for its aromatic properties and biological significance, particularly in pharmaceuticals. The presence of a methyl group and an acetamide functional group suggests potential for hydrogen bonding and solubility in polar solvents. Additionally, the compound contains a phenyl ring substituted with an isopropyl group, which may influence its lipophilicity and biological activity. The overall structure indicates potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be further explored through techniques such as NMR, mass spectrometry, and crystallography. The compound's potential applications could span various fields, including drug development and materials science, depending on its specific biological activity and stability.
Formula:C28H29N3O2
InChI:InChI=1/C28H29N3O2/c1-19(2)20-13-15-23(16-14-20)30-28(33)27(21-9-5-4-6-10-21)31(3)26(32)17-22-18-29-25-12-8-7-11-24(22)25/h4-16,18-19,27,29H,17H2,1-3H3,(H,30,33)
SMILES:CC(C)c1ccc(cc1)NC(=O)C(c1ccccc1)N(C)C(=O)Cc1c[nH]c2ccccc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
PG01
CAS:PG01 is a crystalline cellulose that is used in pharmaceutical preparations. PG01 has been shown to inhibit serine proteases, metalloproteases and other enzymes involved in inflammation. This compound was also found to be stable in acidic conditions at high temperatures. PG01 has been shown to inhibit the activity of surface metalloproteases on the surface of cells, which could be used as an anti-inflammatory treatment for chronic inflammatory diseases such as rheumatoid arthritis. The optimum concentration for PG01 to show its effects is 10 μM. It has been shown to have high values against chemical pesticides and can be used as a carrier material for drugs such as insulin.Formula:C28H29N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:439.55 g/molPG01
CAS:PG01 is a potent CFTR Cl-channel potentiator, effective against ΔF508 (Ka 0.3 μM), and also against E193K, G970R and G551D (CFTR mutants), with Kd values of 0.Formula:C28H29N3O2Purity:99.79%Color and Shape:SolidMolecular weight:439.55Ref: TM-T16516
1mg55.00€1mL*10mM (DMSO)144.00€5mg148.00€10mg215.00€25mg344.00€50mg465.00€100mg630.00€200mg850.00€



