CAS 853138-67-7

Glycinamide, N-acetylglycyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N2-methyl-2-phenyl-

Description:

Glycinamide, N-acetylglycyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N2-methyl-2-phenyl- is a synthetic organic compound characterized by its complex structure, which includes an amide functional group and a benzodioxin moiety. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The presence of the benzodioxin ring may contribute to its pharmacological properties, possibly influencing its interaction with biological targets. As a derivative of glycine, it may also exhibit characteristics related to amino acids, including potential roles in biochemical pathways. The compound's molecular weight, melting point, and specific reactivity would depend on its precise structural configuration, which can affect its stability and behavior in various chemical environments. Given its complexity, it may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific therapeutic effects.

Formula: C₂₁H₂₃N₃O₅

InChI: InChI=1S/C21H23N3O5/c1-14(25)22-13-19(26)24(2)20(15-6-4-3-5-7-15)21(27)23-16-8-9-17-18(12-16)29-11-10-28-17/h3-9,12,20H,10-11,13H2,1-2H3,(H,22,25)(H,23,27)

InChI key: InChIKey=ICVGWGSZTAXAPD-UHFFFAOYSA-N

SMILES: C(C(NC=1C=C2C(=CC1)OCCO2)=O)(N(C(CNC(C)=O)=O)C)C3=CC=CC=C3

Synonyms:

• Glycinamide, N-acetylglycyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N2-methyl-2-phenyl-

WAY-326766

CAS: 853138-67-7

WAY-326766

Purity: ≥98%

Molecular weight: 397.42g/mol

Ref: 54-BUP05185

WAY-326766

CAS: 853138-67-7

WAY-326766 increases ion transport through mutant CFTR and can be used to alter the lifespan of eukaryotes.WAY-326766 can be used to treat cystic fibrosis (CF).

Formula: C₂₁H₂₃N₃O₅

Purity: 98.76%

Color and Shape: Solid

Molecular weight: 397.42

Ref: TM-T77604