CAS 853179-74-5
:2-bromo-6-methyl-pyridine-3-carbaldehyde
Description:
2-Bromo-6-methyl-pyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring structure, which includes a bromine atom and a methyl group at specific positions. The presence of the aldehyde functional group (-CHO) indicates that it is a reactive compound, capable of participating in various chemical reactions, such as nucleophilic additions. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents like ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. Its molecular structure contributes to its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent can enhance reactivity, making it useful in cross-coupling reactions. Additionally, the compound's unique properties may allow for specific interactions in biological systems, warranting further investigation into its biological activity and potential uses in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C7H6BrNO
InChI:InChI=1/C7H6BrNO/c1-5-2-3-6(4-10)7(8)9-5/h2-4H,1H3
SMILES:Cc1ccc(C=O)c(Br)n1
Synonyms:- 2-Bromo-6-methylnicotinaldehyde
- 3-Pyridinecarboxaldehyde, 2-Bromo-6-Methyl-
- 2-Bromo-6-methylpyridine-3-carboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-6-methylnicotinaldehyde
CAS:Formula:C7H6BrNOPurity:97%Color and Shape:SolidMolecular weight:200.03262-Bromo-6-methylnicotinaldehyde
CAS:2-Bromo-6-methylnicotinaldehydePurity:97%Molecular weight:200.03g/mol2-Bromo-6-methylpyridine-3-carboxaldehyde
CAS:2-Bromo-6-methylpyridine-3-carboxaldehyde (BMPCA) is a pharmacological agent that belongs to the group of antagonists. It has been shown to be a potent antagonist at the NMDA receptor and may be used for treating neuropathic pain. BMPCA also has been shown to have competitive inhibition at the naphthyridine receptor, which may allow it to act as an antagonist or an agonist depending on its binding site. The regioisomeric analogs of BMPCA are 2-(2,5-dichloropyridyl)-6-methylpyridine-3-carboxaldehyde and 2-(2,5-dimethylpyridyl)-6-methylpyridine-3-carboxaldehyde. These analogs have been shown to inhibit the growth of tumor cells in vitro and in vivo.
Formula:C7H6BrNOPurity:Min. 95%Molecular weight:200.03 g/mol



