CAS 853298-47-2
:N-[4-[[2-(Methylamino)-4-pyrimidinyl]oxy]phenyl]-N′-[4-[[4-(1-methylethyl)-1-piperazinyl]methyl]-3-(trifluoromethyl)phenyl]urea
Description:
The chemical substance N-[4-[[2-(Methylamino)-4-pyrimidinyl]oxy]phenyl]-N′-[4-[[4-(1-methylethyl)-1-piperazinyl]methyl]-3-(trifluoromethyl)phenyl]urea, with CAS number 853298-47-2, is a complex organic compound characterized by its urea functional group, which is linked to two distinct aromatic moieties. This compound features a pyrimidine ring, a phenolic ether, and a piperazine derivative, contributing to its potential biological activity. The presence of trifluoromethyl and methylamino groups suggests that it may exhibit significant lipophilicity and possibly enhance its interaction with biological targets. The structural complexity indicates that it may be investigated for pharmacological properties, potentially in the realm of oncology or other therapeutic areas. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be essential for understanding its behavior in biological systems. As with many compounds of this nature, safety and handling precautions are necessary due to potential toxicity or reactivity.
Formula:C27H32F3N7O2
InChI:InChI=1S/C27H32F3N7O2/c1-18(2)37-14-12-36(13-15-37)17-19-4-5-21(16-23(19)27(28,29)30)34-26(38)33-20-6-8-22(9-7-20)39-24-10-11-32-25(31-3)35-24/h4-11,16,18H,12-15,17H2,1-3H3,(H,31,32,35)(H2,33,34,38)
InChI key:InChIKey=TZKBNGYRAFKRJC-UHFFFAOYSA-N
SMILES:C(C1=C(C(F)(F)F)C=C(NC(NC2=CC=C(OC3=NC(NC)=NC=C3)C=C2)=O)C=C1)N4CCN(C(C)C)CC4
Synonyms:- N-[4-[[2-(Methylamino)-4-pyrimidinyl]oxy]phenyl]-N′-[4-[[4-(1-methylethyl)-1-piperazinyl]methyl]-3-(trifluoromethyl)phenyl]urea
- Urea, N-[4-[[2-(methylamino)-4-pyrimidinyl]oxy]phenyl]-N′-[4-[[4-(1-methylethyl)-1-piperazinyl]methyl]-3-(trifluoromethyl)phenyl]-
- 1-[4-(2-Methylaminopyrimidin-4-yloxy)phenyl]-3-[4-[(4-isopropylpiperazin-1-yl)methyl]-3-trifluoromethylphenyl]urea
- WNK IN 3
- WNKIN3
- WNK-IN-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
WNK-IN-3
CAS:WNK-IN-3 is a novel allosteric inhibitor of WNK kinase.Formula:C27H32F3N7O2Color and Shape:SolidMolecular weight:543.58
