CymitQuimica logo

CAS 853304-20-8

:

β-Amino-β-ethylbenzenepropanol

Description:
β-Amino-β-ethylbenzenepropanol, identified by its CAS number 853304-20-8, is a chemical compound characterized by the presence of both an amino group and a hydroxyl group, which contribute to its potential as a building block in pharmaceutical synthesis and other applications. This compound features a propanol backbone with an ethylbenzene substituent, which enhances its hydrophobic characteristics while the amino and hydroxyl groups provide sites for hydrogen bonding, influencing its solubility and reactivity. The presence of the amino group suggests potential basicity, while the hydroxyl group can participate in various chemical reactions, including esterification and nucleophilic substitution. β-Amino-β-ethylbenzenepropanol may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features may also allow for interactions with biological targets, which could be explored in drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents.
Formula:C11H17NO
InChI:InChI=1S/C11H17NO/c1-2-11(12,9-13)8-10-6-4-3-5-7-10/h3-7,13H,2,8-9,12H2,1H3
InChI key:InChIKey=PXXQVVBQSRVNGG-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(CC)(CO)N
Synonyms:
  • 2-Amino-2-benzylbutan-1-ol
  • Benzenepropanol, β-amino-β-ethyl-
  • β-Amino-β-ethylbenzenepropanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.