CAS 853310-21-1

3-{5-[2-(trifluoromethyl)phenyl]furan-2-yl}propanoic acid

Description:

3-{5-[2-(Trifluoromethyl)phenyl]furan-2-yl}propanoic acid is a chemical compound characterized by its unique structure, which includes a furan ring, a trifluoromethyl group, and a propanoic acid moiety. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The furan ring contributes to the compound's aromatic properties and may participate in various chemical reactions, such as electrophilic substitutions. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic characteristics, while the carboxylic acid functional group can impart some degree of polarity, allowing for potential interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many compounds containing fluorine, it may also exhibit unique reactivity and stability profiles, which are important considerations in both synthesis and application.

Formula: C₁₄H₁₁F₃O₃

InChI: InChI=1/C14H11F3O3/c15-14(16,17)11-4-2-1-3-10(11)12-7-5-9(20-12)6-8-13(18)19/h1-5,7H,6,8H2,(H,18,19)

SMILES: c1ccc(c(c1)c1ccc(CCC(=O)O)o1)C(F)(F)F