CAS 85333-26-2

4-(Benzyloxy)pyridin-2-amine

Description:

4-(Benzyloxy)pyridin-2-amine, with the CAS number 85333-26-2, is an organic compound characterized by its pyridine ring structure substituted with both an amino group and a benzyloxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity due to the presence of the amino group. The benzyloxy substituent enhances the compound's lipophilicity, which may influence its biological activity and interaction with various receptors or enzymes. As a pyridine derivative, it may participate in hydrogen bonding and exhibit basicity due to the nitrogen atom in the ring. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar compounds often exhibit significant biological activities. Additionally, its synthesis and reactivity can be influenced by the presence of the benzyloxy group, which may serve as a protective or activating group in various chemical reactions.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1/C12H12N2O/c13-12-8-11(6-7-14-12)15-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,13,14)

SMILES: c1ccc(cc1)COc1cc[nH]c(=N)c1

Synonyms:

• 2-Amino-4-(benzyloxy)pyridine

2-Amino-4-(benzyloxy)pyridine

CAS: 85333-26-2

Formula: C₁₂H₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.2365

Ref: IN-DA003GES

4-(Benzyloxy)pyridin-2-amine

CAS: 85333-26-2

4-(Benzyloxy)pyridin-2-amine

Purity: 98%

Molecular weight: 200.24g/mol

Ref: 54-OR79455

4-(Benzyloxy)pyridin-2-amine

CAS: 85333-26-2

Formula: C₁₂H₁₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.241

Ref: 10-F078981