CAS 85342-65-0

4,5,6,7-tetrachloro-2-hydroxy-1H-isoindole-1,3(2H)-dione

Description:

4,5,6,7-tetrachloro-2-hydroxy-1H-isoindole-1,3(2H)-dione, with the CAS number 85342-65-0, is a synthetic organic compound characterized by its complex structure, which includes multiple chlorine substituents and a hydroxyl group. This compound belongs to the isoindole family and features a dione functional group, contributing to its reactivity and potential applications in various chemical processes. The presence of four chlorine atoms significantly enhances its electrophilic character, making it useful in reactions where chlorinated derivatives are desired. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound is often studied for its potential biological activities and applications in materials science, particularly in the development of dyes or pigments due to its vibrant color properties. However, handling and usage should be approached with caution, as chlorinated compounds can exhibit toxicity and environmental persistence. Overall, 4,5,6,7-tetrachloro-2-hydroxy-1H-isoindole-1,3(2H)-dione is a notable compound in organic chemistry with diverse implications.

Formula: C₈HCl₄NO₃

InChI: InChI=1/C8HCl4NO3/c9-3-1-2(4(10)6(12)5(3)11)8(15)13(16)7(1)14/h16H

SMILES: c12c(c(c(c(c1Cl)Cl)Cl)Cl)C(=O)N(C2=O)O

N-Hydroxytetrachlorophthalimide

CAS: 85342-65-0

Formula: C₈HCl₄NO₃

Purity: >98.0%(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 300.90

Ref: 3B-H1765

4,5,6,7-Tetrachloro-2-hydroxy-isoindole-1,3-dione

CAS: 85342-65-0

Formula: C₈HCl₄NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.9104

Ref: IN-DA008FH0

N-Hydroxytetrachlorophthalimide

CAS: 85342-65-0

N-Hydroxytetrachlorophthalimide

Purity: 97%

Molecular weight: 300.91g/mol

Ref: 54-OR72370

4,5,6,7-Tetrachloro-2-hydroxyisoindoline-1,3-dione

CAS: 85342-65-0

Formula: C₈HCl₄NO₃

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 300.9

Ref: 10-F544342

N-Hydroxytetrachlorophthalimide

CAS: 85342-65-0

N-Hydroxytetrachlorophthalimide is an organic compound with the chemical formula CHClNO. It is a primary alcohol that is used in the synthesis of surfactants and fluorinated products. N-Hydroxytetrachlorophthalimide is synthesized by the reaction of chlorine with phthalic anhydride. The product is a white solid that can be purified by recrystallization from water or acetic acid, or by washing with aqueous sodium bicarbonate solution followed by filtration.

Formula: C₈HCl₄NO₃

Purity: Min. 95%

Molecular weight: 300.91 g/mol

Ref: 3D-KDA34265