CAS 85344-77-0
:pglu-his-pro-gly
Description:
The chemical substance known as "pglu-his-pro-gly," with the CAS number 85344-77-0, is a peptide composed of four amino acids: pyroglutamic acid (pGlu), histidine (His), proline (Pro), and glycine (Gly). This peptide exhibits characteristics typical of small peptides, including a relatively low molecular weight and the ability to participate in various biochemical interactions. Pyroglutamic acid, the first amino acid, is known for its role in stabilizing peptide structures and enhancing biological activity. Histidine contributes to the peptide's potential buffering capacity due to its imidazole side chain, while proline introduces rigidity and can influence the peptide's conformation. Glycine, being the simplest amino acid, often serves as a flexible linker in peptide chains. Overall, the unique sequence and composition of pglu-his-pro-gly may impart specific biological functions, making it of interest in fields such as biochemistry, pharmacology, and nutrition. Its properties can be influenced by factors such as pH, temperature, and the presence of other molecules in the environment.
Formula:C18H24N6O6
InChI:InChI=1/C18H24N6O6/c25-14-4-3-11(22-14)16(28)23-12(6-10-7-19-9-21-10)18(30)24-5-1-2-13(24)17(29)20-8-15(26)27/h7,9,11-13H,1-6,8H2,(H,19,21)(H,20,29)(H,22,25)(H,23,28)(H,26,27)/t11-,12-,13-/m0/s1
SMILES:C1C[C@@H](C(=NCC(=O)O)O)N(C1)C(=O)[C@H](Cc1cnc[nH]1)N=C([C@@H]1CCC(=N1)O)O
Synonyms:- TRH-Gly
- Pyr-His-Pro-Gly-OH
- 5-oxo-L-prolyl-L-histidyl-L-prolylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
TRH-Gly
CAS:<p>TRH-Gly Pyr-His-Pro-Gly-OH is a synthetic glucocorticoid that binds to the glucocorticoid receptor. It has been shown to be effective in inhibiting tumor growth and reducing the size of tumors in rats. TRH-Gly Pyr-His-Pro-Gly-OH has also been shown to reduce the release of calcium from intracellular stores, inhibit the biosynthesis of messenger RNA, and inhibit DNA synthesis in human tumor cells. It is used to treat patients with cancer and those with chronic obstructive pulmonary disease (COPD).</p>Formula:C18H24N6O6Purity:Min. 95%Molecular weight:420.42 g/mol
