
CAS 85351-03-7
:2-Methylnonanenitrile
Description:
2-Methylnonanenitrile, with the CAS number 85351-03-7, is an organic compound classified as a nitrile. It features a linear carbon chain with a methyl group attached to the second carbon, resulting in a branched structure. This compound typically exhibits a colorless to pale yellow liquid form at room temperature and has a characteristic odor. Its molecular structure consists of nine carbon atoms, one nitrogen atom, and a corresponding number of hydrogen atoms, contributing to its overall chemical properties. 2-Methylnonanenitrile is known for its relatively low solubility in water but is soluble in organic solvents, making it useful in various chemical applications. It may be utilized in the synthesis of other organic compounds or as an intermediate in chemical reactions. Additionally, like many nitriles, it may exhibit toxicity and should be handled with care, following appropriate safety protocols. Its physical and chemical properties, such as boiling point and density, can vary based on environmental conditions and purity.
Formula:C10H19N
InChI:InChI=1S/C10H19N/c1-3-4-5-6-7-8-10(2)9-11/h10H,3-8H2,1-2H3
InChI key:InChIKey=YZBWLYWBKFUJNQ-UHFFFAOYSA-N
SMILES:C(CC(C#N)C)CCCCC
Synonyms:- 2-Methylnonanenitrile
- Nonanenitrile, 2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.