CAS 85355-10-8
:sodium acetate-2-13C-2-D3
Description:
Sodium acetate-2-13C-2-D3, with the CAS number 85355-10-8, is a stable isotopically labeled compound derived from sodium acetate. It features a sodium cation (Na+) and an acetate anion (CH3COO−) where the carbon atoms are isotopically enriched. Specifically, the "2-13C" indicates that one of the carbon atoms in the acetate group is replaced with the carbon-13 isotope, while "2-D3" signifies that the hydrogen atoms in the methyl group are replaced with deuterium, a heavier isotope of hydrogen. This compound is typically used in various research applications, including metabolic studies and NMR spectroscopy, due to its unique isotopic labeling, which allows for tracking and tracing in biological systems. Sodium acetate itself is a colorless, hygroscopic solid that is soluble in water and has a slightly salty taste. The isotopic labeling enhances its utility in studies involving metabolic pathways, chemical reactions, and environmental tracing, providing insights into molecular behavior and interactions in complex systems.
Formula:C13CD3NaO2
InChI:InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i1+1D3;
SMILES:CC(=O)O.[Na]
Synonyms:- acetic-2-13C-2-D3 acid sodium 97 atom % 13C
- sodium (2-13C,2H3)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sodium Acetate-13C, d3
CAS:Controlled ProductFormula:CCD3O2·NaColor and Shape:NeatMolecular weight:86.045
