CymitQuimica logo

CAS 853574-38-6

:

2-Chloro-1-[4-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1-piperazinyl]ethanone

Description:
2-Chloro-1-[4-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1-piperazinyl]ethanone, with the CAS number 853574-38-6, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a piperazine moiety, and a benzodioxin ring. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the piperazine, which is often linked to pharmacological effects. The chloro substituent may influence its reactivity and solubility in various solvents. The benzodioxin structure can contribute to its stability and interaction with biological targets. As a result, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, this compound represents a class of molecules that may exhibit interesting biological properties due to their unique structural features.
Formula:C15H19ClN2O3
InChI:InChI=1S/C15H19ClN2O3/c16-10-15(19)18-5-3-17(4-6-18)11-12-1-2-13-14(9-12)21-8-7-20-13/h1-2,9H,3-8,10-11H2
InChI key:InChIKey=PTZPMYNSAPNERP-UHFFFAOYSA-N
SMILES:C(C=1C=C2C(=CC1)OCCO2)N3CCN(C(CCl)=O)CC3
Synonyms:
  • Piperazine, 1-(chloroacetyl)-4-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-
  • Ethanone, 2-chloro-1-[4-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1-piperazinyl]-
  • 2-Chloro-1-[4-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1-piperazinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.