CymitQuimica logo

CAS 853574-46-6

:

1-(2-Chloroacetyl)-1,2-dihydro-4,6-dimethyl-3H-pyrazolo[3,4-b]pyridin-3-one

Description:
1-(2-Chloroacetyl)-1,2-dihydro-4,6-dimethyl-3H-pyrazolo[3,4-b]pyridin-3-one is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a chloroacetyl group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of methyl groups at the 4 and 6 positions of the pyridine ring influences its electronic properties and steric hindrance, which can affect its biological activity. The compound is likely to exhibit various pharmacological properties, making it of interest in drug development. Its molecular structure suggests potential interactions with biological targets, and it may serve as a scaffold for further chemical modifications. The CAS number 853574-46-6 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, this compound exemplifies the diversity of heterocyclic chemistry and its relevance in the synthesis of novel therapeutic agents.
Formula:C10H10ClN3O2
InChI:InChI=1S/C10H10ClN3O2/c1-5-3-6(2)12-9-8(5)10(16)13-14(9)7(15)4-11/h3H,4H2,1-2H3,(H,13,16)
InChI key:InChIKey=CXZCOJJJQGZASR-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C(CCl)=O)N1)=NC(C)=CC2C
Synonyms:
  • 1-(2-Chloroacetyl)-1,2-dihydro-4,6-dimethyl-3H-pyrazolo[3,4-b]pyridin-3-one
  • 3H-Pyrazolo[3,4-b]pyridin-3-one, 1-(chloroacetyl)-1,2-dihydro-4,6-dimethyl-
  • 3H-Pyrazolo[3,4-b]pyridin-3-one, 1-(2-chloroacetyl)-1,2-dihydro-4,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.