CAS 853574-48-8
:2,4-Dioxo-1,3-diazaspiro[4.4]nonane-3-butanoic acid
Description:
2,4-Dioxo-1,3-diazaspiro[4.4]nonane-3-butanoic acid, with the CAS number 853574-48-8, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features two carbonyl (C=O) groups, contributing to its dioxo classification, and a butanoic acid moiety, which introduces a carboxylic acid functional group. The presence of nitrogen atoms in the spiro structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of nitrogen-containing compounds to interact with biological systems. The compound's structural complexity may also influence its solubility, stability, and reactivity, making it of interest for further research in synthetic organic chemistry. Additionally, the spirocyclic nature may impart unique conformational properties, which could be relevant in drug design and molecular recognition processes. Overall, 2,4-Dioxo-1,3-diazaspiro[4.4]nonane-3-butanoic acid represents a fascinating subject for study in both theoretical and applied chemistry contexts.
Formula:C11H16N2O4
InChI:InChI=1S/C11H16N2O4/c14-8(15)4-3-7-13-9(16)11(12-10(13)17)5-1-2-6-11/h1-7H2,(H,12,17)(H,14,15)
InChI key:InChIKey=FWUBSDVRUFJATF-UHFFFAOYSA-N
SMILES:O=C1C2(NC(=O)N1CCCC(O)=O)CCCC2
Synonyms:- 1,3-Diazaspiro[4.4]nonane-3-butanoic acid, 2,4-dioxo-
- 2,4-Dioxo-1,3-diazaspiro[4.4]nonane-3-butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.