CAS 85365-92-0

4-methoxy-3,5-dinitrobenzoic acid

Description:

4-Methoxy-3,5-dinitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with two nitro groups and a methoxy group. The presence of the methoxy group (-OCH3) at the para position relative to the carboxylic acid group enhances the compound's solubility in organic solvents and can influence its reactivity. The two nitro groups (-NO2) at the meta positions contribute to the compound's electron-withdrawing properties, which can affect its acidity and reactivity in electrophilic substitution reactions. This compound is typically a yellow crystalline solid and is used in various chemical syntheses and research applications. Its dinitro substitution pattern makes it a potential candidate for further functionalization in organic synthesis. Additionally, due to the presence of nitro groups, it may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Overall, 4-methoxy-3,5-dinitrobenzoic acid is notable for its unique structural features and potential applications in chemical research.

Formula: C₈H₆N₂O₇

InChI: InChI=1/C8H6N2O7/c1-17-7-5(9(13)14)2-4(8(11)12)3-6(7)10(15)16/h2-3H,1H3,(H,11,12)

SMILES: COc1c(cc(cc1N(=O)=O)C(=O)O)N(=O)=O

Synonyms:

• Benzoic Acid, 4-Methoxy-3,5-Dinitro-