CAS 85366-65-0

[3-bromo-4-(trifluoromethoxy)phenyl]methanol

Description:

[3-bromo-4-(trifluoromethoxy)phenyl]methanol, with the CAS number 85366-65-0, is an organic compound characterized by its phenolic structure, which includes a bromine atom and a trifluoromethoxy group attached to a phenyl ring. This compound typically exhibits properties associated with both halogenated and fluorinated organic compounds, such as increased lipophilicity and potential biological activity. The presence of the bromine atom can enhance reactivity, making it useful in various chemical synthesis applications, while the trifluoromethoxy group may impart unique electronic properties and influence solubility. As a phenolic compound, it may also exhibit hydrogen bonding capabilities, affecting its interactions in biological systems. The compound's stability and reactivity can be influenced by the substituents on the aromatic ring, making it of interest in medicinal chemistry and materials science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₆BrF₃O₂

InChI: InChI=1/C8H6BrF3O2/c9-6-3-5(4-13)1-2-7(6)14-8(10,11)12/h1-3,13H,4H2

SMILES: c1cc(c(cc1CO)Br)OC(F)(F)F

Synonyms:

• Benzenemethanol, 3-bromo-4-(trifluoromethoxy)-

Benzenemethanol,3-bromo-4-(trifluoromethoxy)-

CAS: 85366-65-0

Formula: C₈H₆BrF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 271.0312

Ref: IN-DA008FGG

3-Bromo-4-(trifluoromethoxy)benzyl alcohol

CAS: 85366-65-0

3-Bromo-4-(trifluoromethoxy)benzyl alcohol

Formula: C₈H₆BrF₃O₂

Purity: 98%

Color and Shape: white crystalline powder

Molecular weight: 271.03g/mol

Ref: 54-PC2473

(3-Bromo-4-trifluoromethoxy-phenyl)-methanol

CAS: 85366-65-0

Formula: C₈H₆BrF₃O₂

Molecular weight: 271.033

Ref: 10-F032885