CAS 853680-76-9
:4-chloro-7-[(4-methoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidine
Description:
4-Chloro-7-[(4-methoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidine is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyrimidine core. This compound features a chloro substituent at the 4-position and a methoxyphenylmethyl group at the 7-position, contributing to its unique chemical properties. The presence of the chloro group enhances its reactivity and potential for forming various derivatives, while the methoxy group can influence its solubility and biological activity. The compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development and synthesis. Overall, 4-chloro-7-[(4-methoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidine represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C14H14ClN3O
InChI:InChI=1/C14H14ClN3O/c1-19-11-4-2-10(3-5-11)8-18-7-6-12-13(15)16-9-17-14(12)18/h2-5,9H,6-8H2,1H3
SMILES:COc1ccc(cc1)CN1CCc2c(Cl)ncnc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C14H14ClN3OMolecular weight:275.7335
