CymitQuimica logo

CAS 853680-99-6

:

4-(1-Piperazinyl)pyrido[2,3-d]pyrimidine

Description:
4-(1-Piperazinyl)pyrido[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyridine and pyrimidine ring fused together, along with a piperazine moiety. This compound typically exhibits properties associated with both aromatic and basic functionalities due to the presence of nitrogen atoms in its rings. It is often investigated for its potential biological activities, particularly in medicinal chemistry, where it may serve as a scaffold for developing pharmaceuticals targeting various diseases. The piperazine group can enhance solubility and bioavailability, making it a valuable component in drug design. Additionally, the compound may exhibit moderate to high lipophilicity, influencing its pharmacokinetic properties. Its synthesis usually involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Overall, 4-(1-Piperazinyl)pyrido[2,3-d]pyrimidine represents a significant interest in research due to its potential therapeutic applications.
Formula:C11H13N5
InChI:InChI=1S/C11H13N5/c1-2-9-10(13-3-1)14-8-15-11(9)16-6-4-12-5-7-16/h1-3,8,12H,4-7H2
InChI key:InChIKey=CXXVKJRWVCIJGR-UHFFFAOYSA-N
SMILES:C=1(C2=C(N=CN1)N=CC=C2)N3CCNCC3
Synonyms:
  • 1-[Pyrido[2,3-d]pyrimidin-4-yl]piperazine
  • 4-(1-Piperazinyl)pyrido[2,3-d]pyrimidine
  • 4-(Piperazin-1-Yl)Pyrido[2,3-D]Pyrimidine
  • Pyrido[2,3-d]pyrimidine, 4-(1-piperazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.