CAS 853687-23-7
:4-Chloro-β,β-dimethyl-L-phenylalanine
Description:
4-Chloro-β,β-dimethyl-L-phenylalanine, identified by its CAS number 853687-23-7, is an amino acid derivative characterized by the presence of a chlorine atom at the 4-position of the phenyl ring and two methyl groups attached to the beta carbon. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can serve as a valuable building block in synthetic chemistry and pharmaceutical applications. Its structural modifications, particularly the chlorination and dimethylation, can influence its biological activity and solubility. The presence of the bulky dimethyl groups may affect its steric properties, potentially impacting interactions with enzymes or receptors. Additionally, the chlorine substituent can enhance lipophilicity and alter the compound's reactivity. As with many amino acid derivatives, it may exhibit unique properties in terms of solubility in various solvents, stability under different pH conditions, and potential for forming various derivatives through further chemical modifications.
Formula:C11H14ClNO2
InChI:InChI=1S/C11H14ClNO2/c1-11(2,9(13)10(14)15)7-3-5-8(12)6-4-7/h3-6,9H,13H2,1-2H3,(H,14,15)/t9-/m1/s1
InChI key:InChIKey=TZSCJPSLYRHRKB-SECBINFHSA-N
SMILES:C([C@@H](C(O)=O)N)(C)(C)C1=CC=C(Cl)C=C1
Synonyms:- (s)-2-Amino-3-(4-chlorophenyl)-3-methylbutanoic acid
- 4-Chloro-β,β-dimethyl-L-phenylalanine
- L-Phenylalanine, 4-chloro-β,β-dimethyl-
- (2S)-2-Amino-3-(4-chlorophenyl)-3-methylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
