CAS 853687-31-7

1H-Pyrazolo[3,4-d]pyrimidine, 4-(1-piperazinyl)-

Description:

1H-Pyrazolo[3,4-d]pyrimidine, 4-(1-piperazinyl)- is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a piperazine moiety, enhancing its potential for biological activity, particularly in medicinal chemistry. It typically exhibits moderate to high solubility in polar solvents, which is advantageous for pharmaceutical applications. The presence of nitrogen atoms in its structure can influence its reactivity and interaction with biological targets, making it a candidate for drug development. Additionally, this compound may exhibit various pharmacological activities, including potential anti-inflammatory or anti-cancer properties, although specific biological effects would depend on further empirical studies. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced efficacy or reduced side effects. As with many heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems. Overall, 1H-Pyrazolo[3,4-d]pyrimidine, 4-(1-piperazinyl)- represents a versatile scaffold in the field of medicinal chemistry.

Formula: C₉H₁₂N₆

InChI: InChI=1S/C9H12N6/c1-3-15(4-2-10-1)9-7-5-13-14-8(7)11-6-12-9/h5-6,10H,1-4H2,(H,11,12,13,14)

InChI key: InChIKey=NFHSFWKTBQIKAE-UHFFFAOYSA-N

SMILES: C12=C(N=CN=C1NN=C2)N3CCNCC3

4-(Piperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine

CAS: 853687-31-7

4-(Piperazin-1-yl)-1H-pyrazolo[3,4-d]pyrimidine

Purity: 97%

Molecular weight: 204.24g/mol

Ref: 54-OR1074488