CAS 853722-91-5

5,5'-Bis(5-bromo-2-thienyl)-4,4'-dihexyl-2,2'-bithiazole

Description:

5,5'-Bis(5-bromo-2-thienyl)-4,4'-dihexyl-2,2'-bithiazole is an organic compound characterized by its complex structure, which includes bithiazole and thienyl groups. This substance features two brominated thienyl moieties attached to a central bithiazole core, along with hexyl substituents that enhance its solubility and potentially influence its electronic properties. The presence of bromine atoms introduces halogenation, which can affect the compound's reactivity and photophysical properties. Typically, compounds of this nature are studied for their applications in organic electronics, such as organic photovoltaics and light-emitting diodes, due to their ability to facilitate charge transport and light absorption. The hexyl chains contribute to the compound's solubility in organic solvents, making it suitable for various synthetic processes. Additionally, the structural features may impart interesting optical properties, making it a candidate for research in materials science and organic chemistry. Overall, this compound exemplifies the intersection of organic synthesis and materials science, with potential applications in advanced electronic devices.

Formula: C₂₆H₃₀Br₂N₂S₄

InChI: InChI=1S/C26H30Br2N2S4/c1-3-5-7-9-11-17-23(19-13-15-21(27)31-19)33-25(29-17)26-30-18(12-10-8-6-4-2)24(34-26)20-14-16-22(28)32-20/h13-16H,3-12H2,1-2H3

SMILES: CCCCCCc1c(c2ccc(Br)s2)sc(c2nc(CCCCCC)c(c3ccc(Br)s3)s2)n1

Synonyms:

• K0108
• 5,5'-Bis(5-bromothiophen-2-yl)-4,4'-dihexyl-2,2'-bithiazole

5,5'-Bis(5-bromothiophen-2-yl)-4,4'-dihexyl-2,2'-bithiazole

CAS: 853722-91-5

Formula: C₂₆H₃₀Br₂N₂S₄

Molecular weight: 658.5978

Ref: IN-DA00GMIB