CAS 853730-57-1
:(2R)-2-isobutylpiperazine
Description:
(2R)-2-isobutylpiperazine is a chemical compound characterized by its piperazine core, which consists of a six-membered ring containing two nitrogen atoms at opposite positions. The "2R" designation indicates that the isobutyl group is attached to the second carbon of the piperazine ring in a specific stereochemical configuration, which can influence its biological activity and interactions. This compound is typically colorless to pale yellow and may be a liquid or solid depending on its purity and temperature. It is soluble in polar solvents, reflecting the presence of nitrogen atoms that can engage in hydrogen bonding. (2R)-2-isobutylpiperazine is of interest in medicinal chemistry and pharmacology, as piperazine derivatives often exhibit various biological activities, including potential use as anxiolytics or antidepressants. Its specific properties, such as melting point, boiling point, and reactivity, can vary based on the purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H18N2
InChI:InChI=1/C8H18N2/c1-7(2)5-8-6-9-3-4-10-8/h7-10H,3-6H2,1-2H3/t8-/m1/s1
SMILES:CC(C)C[C@@H]1CNCCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
