
CAS 85375-85-5
:SKF 89976
Description:
SKF 89976, with the CAS number 85375-85-5, is a chemical compound that belongs to the class of selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential therapeutic effects in treating various psychiatric disorders, particularly depression and anxiety. The compound exhibits a mechanism of action that involves the inhibition of serotonin reuptake, thereby increasing the availability of serotonin in the synaptic cleft, which can enhance mood and emotional regulation. SKF 89976 is characterized by its specific binding affinity to serotonin transporters, which is crucial for its pharmacological activity. Additionally, it may possess a favorable pharmacokinetic profile, contributing to its efficacy and safety in clinical applications. As with many SSRIs, potential side effects may include gastrointestinal disturbances, changes in weight, and sexual dysfunction, among others. Ongoing research continues to explore its full therapeutic potential and safety profile in various populations.
Formula:C22H25NO2
InChI:InChI=1S/C22H25NO2/c24-22(25)20-13-7-15-23(17-20)16-8-14-21(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,14,20H,7-8,13,15-17H2,(H,24,25)
InChI key:InChIKey=TXQKSMSLZVKQBI-UHFFFAOYSA-N
SMILES:C(=CCCN1CC(C(O)=O)CCC1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 3-Piperidinecarboxylic acid, 1-(4,4-diphenyl-3-butenyl)-
- 3-Piperidinecarboxylic acid, 1-(4,4-diphenyl-3-buten-1-yl)-
- 1-(4,4-Diphenyl-3-buten-1-yl)-3-piperidinecarboxylic acid
- d,l-SKF 89976A
- SKF 89976
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SKF89976A HCl
CAS:SKF89976A: GABA uptake inhibitor, selective for GAT-1, passes blood-brain barrier, active in vivo (IC50: 0.13 μM hGAT-1).Formula:C22H25NO2Color and Shape:SolidMolecular weight:335.44
