CAS 853771-88-7
:4-Bromo-1-methoxy-2-(trifluoromethoxy)benzene
Description:
4-Bromo-1-methoxy-2-(trifluoromethoxy)benzene, with the CAS number 853771-88-7, is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a trifluoromethoxy group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the methoxy group, and a trifluoromethoxy group at the ortho position. The presence of the trifluoromethoxy group imparts significant polarity and can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group contributes to the electron-donating properties of the molecule, influencing its overall electronic structure and reactivity. Additionally, the bromine atom can serve as a leaving group in certain reactions, facilitating further synthetic applications. Overall, this compound is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications in the development of pharmaceuticals and agrochemicals.
Formula:C8H6BrF3O2
InChI:InChI=1/C8H6BrF3O2/c1-13-6-3-2-5(9)4-7(6)14-8(10,11)12/h2-4H,1H3
SMILES:COc1ccc(cc1OC(F)(F)F)Br
Synonyms:- 4-Bromo-2-(trifluoromethoxy)anisole
- Benzene, 4-Bromo-1-Methoxy-2-(Trifluoromethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Bromo-2-(trifluoromethoxy)anisole, 98%
CAS:<p>4-Bromo-2-(trifluoromethoxy)anisole employed in biological evaluation of some analogs of the antitumor agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original </p>Formula:C8H6BrF3O2Purity:98%Color and Shape:Clear colorless, LiquidMolecular weight:271.044-Bromo-2-(trifluoromethoxy)anisole
CAS:Formula:C8H6BrF3O2Purity:95%Color and Shape:LiquidMolecular weight:271.03124-Bromo-2-(trifluoromethoxy)anisole
CAS:4-Bromo-2-(trifluoromethoxy)anisolePurity:95%Molecular weight:271.03g/mol


