CymitQuimica logo

CAS 853784-21-1

:

4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridine

Description:
4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound is saturated, contributing to its stability and reactivity. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmacological agents, often exhibiting activities such as anti-inflammatory, analgesic, or neuroprotective effects. The trifluoromethyl group can enhance the compound's metabolic stability and bioavailability. Additionally, the compound's molecular structure allows for various functionalization possibilities, making it a versatile scaffold in drug design. Overall, 4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridine represents a significant class of compounds with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H8F3N3
InChI:InChI=1S/C7H8F3N3/c8-7(9,10)6-4-1-2-11-3-5(4)12-13-6/h11H,1-3H2,(H,12,13)
InChI key:InChIKey=USWUQQKHXVZMAO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(NN1)CNCC2
Synonyms:
  • 4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridine
  • 1H-Pyrazolo[3,4-c]pyridine, 4,5,6,7-tetrahydro-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.