CAS 85386-84-1
:1-(3-fluoropyridin-2-yl)piperazine
Description:
1-(3-Fluoropyridin-2-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 3-fluoropyridine substituent at one of the piperazine's nitrogen positions imparts unique properties to the molecule, including potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the pyridine ring, which can engage in hydrogen bonding. Its fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. 1-(3-Fluoropyridin-2-yl)piperazine is often studied in medicinal chemistry for its potential applications in drug development, particularly in the fields of neuropharmacology and psychiatry, where piperazine derivatives are known to exhibit various pharmacological effects. As with many chemical substances, safety and handling precautions should be observed, as the compound may have specific toxicity profiles or reactivity characteristics.
Formula:C9H12FN3
InChI:InChI=1/C9H12FN3/c10-8-2-1-3-12-9(8)13-6-4-11-5-7-13/h1-3,11H,4-7H2
SMILES:c1cc(c(nc1)N1CCNCC1)F
Synonyms:- 1-(3-Fluoro-2-pyridinyl)-piperazine
- Piperazine, 1-(3-Fluoro-2-Pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
