CAS 853892-42-9

2-[(6-chloro-3,4-dimethyl-2-oxo-2H-chromen-7-yl)oxy]propanoic acid

Description:

2-[(6-chloro-3,4-dimethyl-2-oxo-2H-chromen-7-yl)oxy]propanoic acid, with the CAS number 853892-42-9, is a chemical compound that belongs to the class of chromen-2-ones, which are characterized by a chromone backbone. This substance features a propanoic acid moiety, indicating it has carboxylic acid functional properties, which can influence its solubility and reactivity. The presence of a chloro group and multiple methyl groups on the chromone structure contributes to its unique chemical behavior and potential biological activity. The compound may exhibit properties such as antioxidant or anti-inflammatory effects, typical of many chromone derivatives. Its structural features suggest it could interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the ether linkage (the -O- connecting the chromone and propanoic acid) may affect its pharmacokinetics and stability. Overall, this compound's characteristics make it a subject of interest for further research in pharmaceutical applications.

Formula: C₁₄H₁₃ClO₅

InChI: InChI=1/C14H13ClO5/c1-6-7(2)14(18)20-11-5-12(10(15)4-9(6)11)19-8(3)13(16)17/h4-5,8H,1-3H3,(H,16,17)

SMILES: Cc1c(C)c(=O)oc2cc(c(cc12)Cl)OC(C)C(=O)O

2-[(6-chloro-3,4-dimethyl-2-oxo-2H-chromen-7-yl)oxy]propanoic acid

CAS: 853892-42-9

Formula: C₁₄H₁₃ClO₅

Molecular weight: 296.7030

Ref: IN-DA004U1I