
CAS 85391-24-8
:1-Propyl-2,4-imidazolidinedione
Description:
1-Propyl-2,4-imidazolidinedione, also known as propylurea, is a chemical compound characterized by its imidazolidinedione structure, which features a five-membered ring containing two carbonyl groups and two nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. It is known for its role as a pharmaceutical intermediate and may exhibit biological activity, particularly in relation to its potential use in medicinal chemistry. The presence of the propyl group contributes to its hydrophobic characteristics, influencing its interaction with biological systems. Additionally, 1-propyl-2,4-imidazolidinedione may participate in various chemical reactions, including those typical of amides and ureas, making it a versatile compound in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H10N2O2
InChI:InChI=1S/C6H10N2O2/c1-2-3-8-4-5(9)7-6(8)10/h2-4H2,1H3,(H,7,9,10)
InChI key:InChIKey=MZRJHJCATGZKTC-UHFFFAOYSA-N
SMILES:C(CC)N1C(=O)NC(=O)C1
Synonyms:- 2,4-Imidazolidinedione, 1-propyl-
- 1-n-Propylhydantoin
- 1-Propyl-2,4-imidazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.