
CAS 85392-28-5
:2,5-Diethyl-3,4-dihydro-2H-pyran-2-methanol
Description:
2,5-Diethyl-3,4-dihydro-2H-pyran-2-methanol, with CAS number 85392-28-5, is an organic compound characterized by its unique structure, which includes a pyran ring and multiple ethyl groups. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of ethyl groups. The dihydropyran moiety contributes to its reactivity, particularly in nucleophilic reactions, while the methanol functional group can participate in hydrogen bonding, influencing its physical properties. It may exhibit moderate volatility and a relatively low boiling point, typical of similar organic compounds. The presence of multiple ethyl groups can enhance its hydrophobic characteristics, making it less soluble in water. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 2,5-Diethyl-3,4-dihydro-2H-pyran-2-methanol is of interest in various chemical applications, including synthesis and potential use in pharmaceuticals or agrochemicals.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-3-9-5-6-10(4-2,8-11)12-7-9/h7,11H,3-6,8H2,1-2H3
InChI key:InChIKey=IHEGBLXFHBDDSW-UHFFFAOYSA-N
SMILES:C(C)C1(CO)CCC(CC)=CO1
Synonyms:- 2,5-Diethyl-3,4-dihydro-2H-pyran-2-methanol
- 2H-Pyran-2-methanol, 2,5-diethyl-3,4-dihydro-
- (2,5-Diethyl-3,4-dihydro-2H-pyran-2-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.