CAS 854020-89-6
:(3-bromophenyl)-(o-tolyl)methanone
Description:
(3-bromophenyl)-(o-tolyl)methanone, identified by its CAS number 854020-89-6, is an organic compound characterized by its ketone functional group and the presence of bromine and methyl substituents on the aromatic rings. This compound features a phenyl ring substituted at the meta position with a bromine atom and another phenyl ring (o-tolyl) that has a methyl group at the ortho position. The presence of these substituents influences its chemical reactivity, solubility, and potential applications in organic synthesis and medicinal chemistry. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structure, which can affect their biological activity and interaction with other molecules. Additionally, the bromine atom can serve as a site for further chemical modifications, making it a valuable intermediate in the synthesis of more complex organic compounds. Safety and handling considerations should be taken into account, as halogenated compounds can pose environmental and health risks.
Formula:C14H11BrO
InChI:InChI=1/C14H11BrO/c1-10-5-2-3-8-13(10)14(16)11-6-4-7-12(15)9-11/h2-9H,1H3
SMILES:Cc1ccccc1C(=O)c1cccc(c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.