CAS 854035-85-1
:N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4-difluorophenyl)acetamide
Description:
N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4-difluorophenyl)acetamide is a chemical compound characterized by its unique structural features, which include a thiazole ring and a difluorophenyl group. The presence of a chloromethyl group enhances its reactivity, making it suitable for various chemical transformations. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, which may include antimicrobial or antitumor effects, although specific biological data would depend on empirical studies. The thiazole moiety is known for its role in pharmaceuticals, often contributing to the compound's efficacy. Additionally, the difluorophenyl group may influence the lipophilicity and overall pharmacokinetic profile of the substance. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity associated with halogenated compounds. Overall, N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4-difluorophenyl)acetamide represents a class of compounds with significant potential in medicinal chemistry and material science.
Formula:C12H9ClF2N2OS
InChI:InChI=1S/C12H9ClF2N2OS/c1-7(18)17(12-16-9(5-13)6-19-12)11-3-2-8(14)4-10(11)15/h2-4,6H,5H2,1H3
InChI key:InChIKey=XZQXSPYURCTKRJ-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C1=C(F)C=C(F)C=C1)C2=NC(CCl)=CS2
Synonyms:- Acetamide, N-[4-(chloromethyl)-2-thiazolyl]-N-(2,4-difluorophenyl)-
- N-[4-(Chloromethyl)-2-thiazolyl]-N-(2,4-difluorophenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.