CymitQuimica logo

CAS 854035-91-9

:

N-[1-(4-Bromophenyl)propyl]-2-chloroacetamide

Description:
N-[1-(4-Bromophenyl)propyl]-2-chloroacetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The presence of a bromophenyl group suggests that it may exhibit significant hydrophobic interactions, influencing its solubility and reactivity. The chloroacetamide moiety contributes to its potential as a reactive site in various chemical reactions, including nucleophilic substitutions. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to specific pharmacological properties. Its molecular structure implies that it may interact with biological targets, making it a candidate for further investigation in drug development. Additionally, the presence of halogens, such as bromine and chlorine, can enhance the compound's lipophilicity and stability, which are important factors in the design of pharmaceuticals. Overall, N-[1-(4-Bromophenyl)propyl]-2-chloroacetamide presents a unique combination of characteristics that warrant further exploration in both synthetic and biological contexts.
Formula:C11H13BrClNO
InChI:InChI=1S/C11H13BrClNO/c1-2-10(14-11(15)7-13)8-3-5-9(12)6-4-8/h3-6,10H,2,7H2,1H3,(H,14,15)
InChI key:InChIKey=OWCKJSSTWUEOET-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)(CC)C1=CC=C(Br)C=C1
Synonyms:
  • Acetamide, N-[1-(4-bromophenyl)propyl]-2-chloro-
  • N-[1-(4-Bromophenyl)propyl]-2-chloroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.