CAS 854035-95-3

1-[2-Nitro-4-(1-piperidinylsulfonyl)phenyl]-4-piperidinecarboxylic acid

Description:

1-[2-Nitro-4-(1-piperidinylsulfonyl)phenyl]-4-piperidinecarboxylic acid, with the CAS number 854035-95-3, is a chemical compound characterized by its complex structure, which includes a nitro group, a piperidine moiety, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the nitro group suggests it may participate in electrophilic reactions, while the piperidine rings can influence its solubility and interaction with biological targets. The sulfonyl group enhances its polarity, which may affect its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly as an inhibitor or modulator of specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. As with many compounds in this category, safety and handling precautions are essential due to potential toxicity associated with nitro and sulfonyl groups.

Formula: C₁₇H₂₃N₃O₆S

InChI: InChI=1S/C17H23N3O6S/c21-17(22)13-6-10-18(11-7-13)15-5-4-14(12-16(15)20(23)24)27(25,26)19-8-2-1-3-9-19/h4-5,12-13H,1-3,6-11H2,(H,21,22)

InChI key: InChIKey=BWUWTHGRIRHNAV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC(S(=O)(=O)N2CCCCC2)=C1)N3CCC(C(O)=O)CC3

Synonyms:

• 1-[2-Nitro-4-(1-piperidinylsulfonyl)phenyl]-4-piperidinecarboxylic acid
• 1-[2-Nitro-4-(piperidine-1-sulfonyl)phenyl]piperidine-4-carboxylic acid
• 4-Piperidinecarboxylic acid, 1-[2-nitro-4-(1-piperidinylsulfonyl)phenyl]-
• 1-[2-Nitro-4-(piperidin-1-ylsulfonyl)phenyl]piperidine-4-carboxylic acid

1-[2-Nitro-4-(piperidine-1-sulfonyl)phenyl]piperidine-4-carboxylic acid

Controlled Product

CAS: 854035-95-3

1-[2-Nitro-4-(piperidine-1-sulfonyl)phenyl]piperidine-4-carboxylic acid is a peptide which can be used as a research tool for studying protein interactions, antibody production, cell biology, and pharmacology. 1-[2-Nitro-4-(piperidine-1-sulfonyl)phenyl]piperidine-4-carboxylic acid has been shown to inhibit the activity of ion channels and receptor proteins by binding to them in a competitive manner. It also acts as an activator of ligand gated ion channels.

Formula: C₁₇H₂₃N₃O₆S

Purity: Min. 95%

Molecular weight: 397.4 g/mol

Ref: 3D-EJB03595