CAS 854036-06-9

Ethanone, 2-chloro-1-(5-fluoro-2-methoxyphenyl)-

Description:

Ethanone, 2-chloro-1-(5-fluoro-2-methoxyphenyl)-, also known by its CAS number 854036-06-9, is an organic compound characterized by its functional groups and molecular structure. It features a ketone functional group (ethanone) and a chloro substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of a 5-fluoro-2-methoxyphenyl group indicates that the compound has both halogen and ether functionalities, which can influence its chemical behavior, solubility, and biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic ring and substituents, making them of interest in medicinal chemistry and drug development. The specific arrangement of atoms and the presence of electronegative elements like chlorine and fluorine can also affect the compound's electronic properties, potentially leading to unique interactions in biological systems. Overall, this compound's characteristics suggest it may have applications in pharmaceuticals or agrochemicals, although further studies would be necessary to elucidate its full potential.

Formula: C₉H₈ClFO₂

InChI: InChI=1S/C9H8ClFO2/c1-13-9-3-2-6(11)4-7(9)8(12)5-10/h2-4H,5H2,1H3

InChI key: InChIKey=ANFSUNDCMZJLCI-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C1=C(OC)C=CC(F)=C1

Synonyms:

• 2-Chloro-1-(5-fluoro-2-methoxyphenyl)ethan-1-one
• 2-Chloro-1-(5-fluoro-2-methoxyphenyl)ethanone
• Ethanone, 2-chloro-1-(5-fluoro-2-methoxyphenyl)-