CAS 85405-01-2
:(6S,8S)-3-(2-deoxy-alpha-D-erythro-pentofuranosyl)-8-hydroxy-6-methyl-4,6,7,8-tetrahydropyrimido[1,2-a]purin-10(3H)-one
Description:
The chemical substance with the name "(6S,8S)-3-(2-deoxy-alpha-D-erythro-pentofuranosyl)-8-hydroxy-6-methyl-4,6,7,8-tetrahydropyrimido[1,2-a]purin-10(3H)-one" and CAS number "85405-01-2" is a nucleoside analog, which is characterized by its structural features that include a purine base fused to a pyrimidine ring system. This compound exhibits a specific stereochemistry, indicated by the (6S,8S) configuration, which is crucial for its biological activity. The presence of a 2-deoxy-pentofuranosyl moiety suggests that it is a derivative of ribonucleosides, potentially influencing its interaction with nucleic acid synthesis and function. The hydroxyl and methyl groups contribute to its solubility and reactivity, while the tetrahydropyrimidine structure may enhance its stability and bioavailability. Such compounds are often investigated for their antiviral or anticancer properties, as they can interfere with nucleic acid metabolism. Overall, this substance represents a complex molecular architecture that may have significant implications in medicinal chemistry and pharmacology.
Formula:C14H19N5O5
InChI:InChI=1/C14H19N5O5/c1-6-2-9(22)19-13(23)11-12(17-14(19)16-6)18(5-15-11)10-3-7(21)8(4-20)24-10/h5-10,20-22H,2-4H2,1H3,(H,16,17)/t6-,7-,8+,9-,10-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(6S,8S)-8-Hydroxy-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-4,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one
CAS:Controlled ProductFormula:C14H19N5O5Color and Shape:NeatMolecular weight:337.33
