CAS 85409-44-5
:2,2-Dichloro-N-[1-(chloromethyl)-2-(4-chlorophenyl)-2-oxoethyl]acetamide
Description:
2,2-Dichloro-N-[1-(chloromethyl)-2-(4-chlorophenyl)-2-oxoethyl]acetamide, with CAS number 85409-44-5, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. It features dichloro and chloromethyl substituents, contributing to its reactivity and potential applications in various chemical processes. The presence of an acetamide group indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and boiling point. This compound is often studied for its potential use in agrochemicals, particularly as a herbicide or pesticide, due to its chlorinated aromatic structure, which can enhance biological activity. Additionally, the presence of multiple chlorine atoms may impart specific environmental persistence and toxicity characteristics. As with many chlorinated compounds, safety precautions are essential when handling this substance, given the potential for harmful effects on human health and the environment. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.
Formula:C11H9Cl4NO2
InChI:InChI=1S/C11H9Cl4NO2/c12-5-8(16-11(18)10(14)15)9(17)6-1-3-7(13)4-2-6/h1-4,8,10H,5H2,(H,16,18)
InChI key:InChIKey=MLVKMSCFQIQULM-UHFFFAOYSA-N
SMILES:C(C(NC(C(Cl)Cl)=O)CCl)(=O)C1=CC=C(Cl)C=C1
Synonyms:- ( -)-2,2-Dichloro-N-(p-chloro-alpha(chloromethyl)phenacyl)acetamide
- (±)-2,2-Dichloro-N-[p-chloro-α-(chloromethyl)phenacyl] acetamide
- Acetamide, 2,2-dichloro-N-(1-(chloromethyl)-2-(4-chlorophenyl)-2-oxoethyl)-
- Acetamide, 2,2-dichloro-N-(p-chloro-alpha-(chloromethyl)phenacyl)-
- Acetamide, 2,2-dichloro-N-[p-chloro-α-(chloromethyl)phenacyl]-
- Cloponona
- Cloponone
- Cloponone [INN:BAN]
- Clopononum
- 2,2-Dichloro-N-(1-(chloromethyl)-2-(4-chlorophenyl)-2-oxoethyl)acetamide
- 2,2-Dichloro-N-[1-(chloromethyl)-2-(4-chlorophenyl)-2-oxoethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cloponone 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C11H9Cl4NO2Color and Shape:Single SolutionMolecular weight:329.01
