CymitQuimica logo

CAS 854137-61-4

:

2,3-Dihydro-3-methyl-2-oxo-1H-indole-5-sulfonyl chloride

Description:
2,3-Dihydro-3-methyl-2-oxo-1H-indole-5-sulfonyl chloride, with the CAS number 854137-61-4, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a bicyclic indole structure, which contributes to its unique chemical properties and potential biological activity. The presence of the carbonyl group (ketone) and the sulfonyl chloride enhances its electrophilic character, making it useful in various synthetic applications, particularly in medicinal chemistry for the development of pharmaceuticals. It is typically a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage. The compound's reactivity allows it to participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. As with many sulfonyl chlorides, it may release hydrochloric acid upon reaction, necessitating appropriate safety precautions during use.
Formula:C9H8ClNO3S
InChI:InChI=1S/C9H8ClNO3S/c1-5-7-4-6(15(10,13)14)2-3-8(7)11-9(5)12/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=JIIBYPZOZQAHSR-UHFFFAOYSA-N
SMILES:CC1C=2C(NC1=O)=CC=C(S(Cl)(=O)=O)C2
Synonyms:
  • 1H-Indole-5-sulfonyl chloride, 2,3-dihydro-3-methyl-2-oxo-
  • 2,3-Dihydro-3-methyl-2-oxo-1H-indole-5-sulfonyl chloride
Found 4 products.