CAS 854137-70-5

1,5-Dihydro-3-(2-thienyl)-5-thioxo-4H-1,2,4-triazole-4-propanoic acid

Description:

1,5-Dihydro-3-(2-thienyl)-5-thioxo-4H-1,2,4-triazole-4-propanoic acid is a chemical compound characterized by its unique triazole ring structure, which contributes to its biological activity. This compound features a thienyl group, enhancing its potential for various applications, particularly in pharmaceuticals. The presence of a thioxo group indicates that it may exhibit thioketone-like properties, which can influence its reactivity and interaction with biological targets. The propanoic acid moiety suggests that it may possess acidic characteristics, potentially affecting its solubility and stability in different environments. This compound is of interest in medicinal chemistry due to its potential as a bioactive agent, and its structural features may allow for interactions with specific enzymes or receptors. Additionally, the compound's stability, solubility, and reactivity can be influenced by factors such as pH and temperature, making it a subject of study in various chemical and biological contexts. Overall, this compound exemplifies the complexity and diversity of triazole derivatives in chemical research.

Formula: C₉H₉N₃O₂S₂

InChI: InChI=1S/C9H9N3O2S2/c13-7(14)3-4-12-8(10-11-9(12)15)6-2-1-5-16-6/h1-2,5H,3-4H2,(H,11,15)(H,13,14)

InChI key: InChIKey=LDVAKKHSVPWPLE-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C(=NNC1=S)C2=CC=CS2

Synonyms:

• 4H-1,2,4-Triazole-4-propanoic acid, 1,5-dihydro-3-(2-thienyl)-5-thioxo-
• 1,5-Dihydro-3-(2-thienyl)-5-thioxo-4H-1,2,4-triazole-4-propanoic acid

3-[3-Sulfanyl-5-(thiophen-2-yl)-4H-1,2,4-triazol-4-yl]propanoic acid

CAS: 854137-70-5

Versatile small molecule scaffold

Formula: C₉H₉N₃O₂S₂

Purity: Min. 95%

Molecular weight: 255.3 g/mol

Ref: 3D-EJB13770