
CAS 854140-09-3
:(3S)-N-(1-Methylethyl)-3-pyrrolidinamine
Description:
(3S)-N-(1-Methylethyl)-3-pyrrolidinamine, identified by its CAS number 854140-09-3, is a chemical compound characterized by its pyrrolidine ring, which is a five-membered cyclic amine. The compound features a chiral center at the third position of the pyrrolidine, contributing to its stereochemistry. The presence of the isopropyl group (1-methylethyl) attached to the nitrogen atom enhances its steric properties and may influence its biological activity. This compound is typically studied in the context of medicinal chemistry, where its structural features may be relevant for interactions with biological targets, such as receptors or enzymes. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Understanding its characteristics is crucial for applications in drug development and synthesis.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-6(2)9-7-3-4-8-5-7/h6-9H,3-5H2,1-2H3/t7-/m0/s1
InChI key:InChIKey=FUOPYXYKWKCPLR-ZETCQYMHSA-N
SMILES:N(C(C)C)[C@H]1CCNC1
Synonyms:- 3-Pyrrolidinamine, N-(1-methylethyl)-, (3S)-
- (3S)-N-(1-Methylethyl)-3-pyrrolidinamine
- (3S)-N-(Propan-2-yl)pyrrolidin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.