CAS 854179-21-8

2,5-Dimethyl-α-propylbenzenemethanol

Description:

2,5-Dimethyl-α-propylbenzenemethanol, identified by its CAS number 854179-21-8, is an organic compound characterized by its aromatic structure and the presence of multiple alkyl substituents. This compound features a benzene ring with two methyl groups located at the 2 and 5 positions, and a propyl group attached to the alpha position of the benzyl alcohol moiety. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can influence its solubility and reactivity. Generally, compounds of this nature exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, while the alkyl groups contribute to hydrophobic characteristics. This balance can affect its physical properties, such as boiling and melting points, as well as its behavior in various chemical reactions. Additionally, the compound may have applications in organic synthesis or as a potential intermediate in the production of other chemical substances. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation.

Formula: C₁₂H₁₈O

InChI: InChI=1S/C12H18O/c1-4-5-12(13)11-8-9(2)6-7-10(11)3/h6-8,12-13H,4-5H2,1-3H3

InChI key: InChIKey=KDVRXIHSHBHNOR-UHFFFAOYSA-N

SMILES: C(CCC)(O)C1=C(C)C=CC(C)=C1

Synonyms:

• Benzenemethanol, 2,5-dimethyl-α-propyl-
• Benzyl alcohol, 2,5-dimethyl-α-propyl-
• 2,5-Dimethyl-α-propylbenzenemethanol